Difference between revisions of "CPD-8124"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DGMP == * common-name: ** dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ltfmzdnnppeqng-k...") |
(Created page with "Category:metabolite == Metabolite CPD-8202 == * common-name: ** a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine == Reaction(s) known to consume...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8202 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.4.1.134-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine}} |
| − | |||
| − | |||
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-8202
- common-name:
- a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
