Difference between revisions of "CPD-8157"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DTDP-RHAMNOSE == * common-name: ** dtdp-β-l-rhamnose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c...")
(Created page with "Category:metabolite == Metabolite CPD-24189 == == Reaction(s) known to consume the compound == * RXN-22204 == Reaction(s) known to produce the compound == * RXN-2220...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DTDP-RHAMNOSE ==
+
== Metabolite CPD-24189 ==
* common-name:
 
** dtdp-β-l-rhamnose
 
* smiles:
 
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
 
* inchi-key:
 
** zosqfdvxnqfkby-cgaxjhmrsa-l
 
* molecular-weight:
 
** 546.317
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-22204]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DTDPDEHYRHAMREDUCT-RXN]]
+
* [[RXN-22203]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtdp-β-l-rhamnose}}
 
{{#set: inchi-key=inchikey=zosqfdvxnqfkby-cgaxjhmrsa-l}}
 
{{#set: molecular-weight=546.317}}
 

Revision as of 11:15, 15 January 2021

Metabolite CPD-24189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality