Difference between revisions of "CPD-8157"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INOSINE == * common-name: ** inosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** ugqmrvrmyyaskq-kqynxxcusa...") |
(Created page with "Category:metabolite == Metabolite CPD-8157 == * common-name: ** 1-palmitoyl-2-oleoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)cop(...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8157 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-palmitoyl-2-oleoyl-phosphatidylcholine |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)cop(=o)([o-])occ[n+](c)(c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wtjkggkopkcxll-vyobokexsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 760.085 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8360]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-palmitoyl-2-oleoyl-phosphatidylcholine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wtjkggkopkcxll-vyobokexsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=760.085}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-8157
- common-name:
- 1-palmitoyl-2-oleoyl-phosphatidylcholine
- smiles:
- ccccccccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)cop(=o)([o-])occ[n+](c)(c)c
- inchi-key:
- wtjkggkopkcxll-vyobokexsa-n
- molecular-weight:
- 760.085
