Difference between revisions of "CPD-8157"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INOSINE == * common-name: ** inosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** ugqmrvrmyyaskq-kqynxxcusa...")
(Created page with "Category:metabolite == Metabolite HOMOGENTISATE == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) * inchi-key: ** igmnyecmumzddf-uhfffaoysa-m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INOSINE ==
+
== Metabolite HOMOGENTISATE ==
 
* common-name:
 
* common-name:
** inosine
+
** homogentisate
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+
** c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
 
* inchi-key:
 
* inchi-key:
** ugqmrvrmyyaskq-kqynxxcusa-n
+
** igmnyecmumzddf-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 268.229
+
** 167.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[INOPHOSPHOR-RXN]]
+
* [[RXN-14929]]
 +
* [[RXN-2541]]
 +
* [[RXN-2761]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENODEAMIN-RXN]]
+
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
* [[I5NT]]
+
* [[HPPD]]
* [[INOPHOSPHOR-RXN]]
 
* [[RXN-7607]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=inosine}}
+
{{#set: common-name=homogentisate}}
{{#set: inchi-key=inchikey=ugqmrvrmyyaskq-kqynxxcusa-n}}
+
{{#set: inchi-key=inchikey=igmnyecmumzddf-uhfffaoysa-m}}
{{#set: molecular-weight=268.229}}
+
{{#set: molecular-weight=167.141}}

Revision as of 14:56, 5 January 2021

Metabolite HOMOGENTISATE

  • common-name:
    • homogentisate
  • smiles:
    • c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
  • inchi-key:
    • igmnyecmumzddf-uhfffaoysa-m
  • molecular-weight:
    • 167.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality