Difference between revisions of "CPD-8157"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01330 == * transcription-direction: ** negative * right-end-position: ** 83971 * left-end-position: ** 80457 * centisome-position: ** 52.683723...")
(Created page with "Category:metabolite == Metabolite INOSINE == * common-name: ** inosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** ugqmrvrmyyaskq-kqynxxcusa...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ01330 ==
+
== Metabolite INOSINE ==
* transcription-direction:
+
* common-name:
** negative
+
** inosine
* right-end-position:
+
* smiles:
** 83971
+
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
* left-end-position:
+
* inchi-key:
** 80457
+
** ugqmrvrmyyaskq-kqynxxcusa-n
* centisome-position:
+
* molecular-weight:
** 52.683723   
+
** 268.229
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[INOPHOSPHOR-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[ADENODEAMIN-RXN]]
** Category: [[annotation]]
+
* [[I5NT]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[INOPHOSPHOR-RXN]]
{{#set: transcription-direction=negative}}
+
* [[RXN-7607]]
{{#set: right-end-position=83971}}
+
== Reaction(s) of unknown directionality ==
{{#set: left-end-position=80457}}
+
{{#set: common-name=inosine}}
{{#set: centisome-position=52.683723    }}
+
{{#set: inchi-key=inchikey=ugqmrvrmyyaskq-kqynxxcusa-n}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: molecular-weight=268.229}}
{{#set: nb reaction associated=1}}
 

Revision as of 20:33, 18 December 2020

Metabolite INOSINE

  • common-name:
    • inosine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • ugqmrvrmyyaskq-kqynxxcusa-n
  • molecular-weight:
    • 268.229

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality