Difference between revisions of "CPD-8159"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13667 == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c * i...") |
(Created page with "Category:metabolite == Metabolite CPD-8462 == * common-name: ** pentadecanoate * smiles: ** ccccccccccccccc([o-])=o * inchi-key: ** wqepluugtldzjy-uhfffaoysa-m * molecular...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8462 == |
* common-name: | * common-name: | ||
| − | ** | + | ** pentadecanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccccccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wqepluugtldzjy-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 241.393 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pentadecanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wqepluugtldzjy-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=241.393}} |
Revision as of 14:59, 5 January 2021
Contents
Metabolite CPD-8462
- common-name:
- pentadecanoate
- smiles:
- ccccccccccccccc([o-])=o
- inchi-key:
- wqepluugtldzjy-uhfffaoysa-m
- molecular-weight:
- 241.393
