Difference between revisions of "CPD-8161"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18490 == * common-name: ** (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccccc=cc(sccnc...")
(Created page with "Category:metabolite == Metabolite CPD-11408 == * common-name: ** triiodothyronine sulfate * smiles: ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18490 ==
+
== Metabolite CPD-11408 ==
 
* common-name:
 
* common-name:
** (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa
+
** triiodothyronine sulfate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
 
* inchi-key:
 
* inchi-key:
** avrcofdawhwkmb-mnthwfihsa-j
+
** xbqyqxvjbndcgy-lbprgkrzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 1104.05
+
** 730.028
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17110]]
+
* [[RXN-10615]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa}}
+
{{#set: common-name=triiodothyronine sulfate}}
{{#set: inchi-key=inchikey=avrcofdawhwkmb-mnthwfihsa-j}}
+
{{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}}
{{#set: molecular-weight=1104.05}}
+
{{#set: molecular-weight=730.028}}

Revision as of 11:19, 15 January 2021

Metabolite CPD-11408

  • common-name:
    • triiodothyronine sulfate
  • smiles:
    • c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
  • inchi-key:
    • xbqyqxvjbndcgy-lbprgkrzsa-m
  • molecular-weight:
    • 730.028

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality