Difference between revisions of "CPD-8161"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16130 RXN-16130] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-19339 == * common-name: ** α-d-sedoheptulopyranose 7-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1) * inc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-19339 == |
| − | * | + | * common-name: |
| − | ** | + | ** α-d-sedoheptulopyranose 7-phosphate |
| − | * | + | * smiles: |
| − | ** [ | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1) |
| − | = | + | * inchi-key: |
| − | + | ** cbidvwsruuodhl-ovhbtucosa-l | |
| − | + | * molecular-weight: | |
| − | * | + | ** 288.147 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-9140]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=α-d-sedoheptulopyranose 7-phosphate}} |
| − | == | + | {{#set: inchi-key=inchikey=cbidvwsruuodhl-ovhbtucosa-l}} |
| − | * [[ | + | {{#set: molecular-weight=288.147}} |
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-19339
- common-name:
- α-d-sedoheptulopyranose 7-phosphate
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1)
- inchi-key:
- cbidvwsruuodhl-ovhbtucosa-l
- molecular-weight:
- 288.147
