Difference between revisions of "CPD-8161"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19339 == * common-name: ** α-d-sedoheptulopyranose 7-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1) * inc...") |
(Created page with "Category:metabolite == Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA == * common-name: ** a 2-methyl branched 2,3,4-saturated fatty acyl-coa == Reaction(s) known to cons...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2-methyl branched 2,3,4-saturated fatty acyl-coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-483]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2-methyl branched 2,3,4-saturated fatty acyl-coa}} |
| − | |||
| − | |||
Revision as of 14:59, 5 January 2021
Contents
Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA
- common-name:
- a 2-methyl branched 2,3,4-saturated fatty acyl-coa
