Difference between revisions of "CPD-8162"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THR-tRNAs == * common-name: ** a trnathr == Reaction(s) known to consume the compound == * THREONINE--TRNA-LIGASE-RXN == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** oirdtqyftabqoq-kqynxx...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THR-tRNAs ==
+
== Metabolite ADENOSINE ==
 
* common-name:
 
* common-name:
** a trnathr
+
** adenosine
 +
* smiles:
 +
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
 +
* inchi-key:
 +
** oirdtqyftabqoq-kqynxxcusa-n
 +
* molecular-weight:
 +
** 267.244
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[THREONINE--TRNA-LIGASE-RXN]]
+
* [[ADENODEAMIN-RXN]]
 +
* [[ADENOSINE-KINASE-RXN]]
 +
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
 +
* [[ADENPHOSPHOR-RXN]]
 +
* [[ADNK]]
 +
* [[ADNKm]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
 +
* [[ADENPHOSPHOR-RXN]]
 +
* [[AMP-DEPHOSPHORYLATION-RXN]]
 +
* [[AMP5N]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnathr}}
+
{{#set: common-name=adenosine}}
 +
{{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}}
 +
{{#set: molecular-weight=267.244}}

Revision as of 14:53, 5 January 2021

Metabolite ADENOSINE

  • common-name:
    • adenosine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
  • inchi-key:
    • oirdtqyftabqoq-kqynxxcusa-n
  • molecular-weight:
    • 267.244

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality