Difference between revisions of "CPD-8162"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Aliphatic-L-Amino-Acids == * common-name: ** an aliphatic l-amino acid == Reaction(s) known to consume the compound == == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** oirdtqyftabqoq-kqynxx...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ADENOSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** adenosine |
| + | * smiles: | ||
| + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) | ||
| + | * inchi-key: | ||
| + | ** oirdtqyftabqoq-kqynxxcusa-n | ||
| + | * molecular-weight: | ||
| + | ** 267.244 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ADENODEAMIN-RXN]] | ||
| + | * [[ADENOSINE-KINASE-RXN]] | ||
| + | * [[ADENOSYLHOMOCYSTEINASE-RXN]] | ||
| + | * [[ADENPHOSPHOR-RXN]] | ||
| + | * [[ADNK]] | ||
| + | * [[ADNKm]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ADENOSYLHOMOCYSTEINASE-RXN]] |
| + | * [[ADENPHOSPHOR-RXN]] | ||
| + | * [[AMP-DEPHOSPHORYLATION-RXN]] | ||
| + | * [[AMP5N]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=adenosine}} |
| + | {{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}} | ||
| + | {{#set: molecular-weight=267.244}} | ||
Revision as of 18:53, 14 January 2021
Contents
Metabolite ADENOSINE
- common-name:
- adenosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
- inchi-key:
- oirdtqyftabqoq-kqynxxcusa-n
- molecular-weight:
- 267.244
