Difference between revisions of "CPD-8163"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4081 == * common-name: ** 4α-methyl-5α-ergosta-8,24-dien-3β-ol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1...") |
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P == * common-name: ** 7,8-dihydroneopterin 3'-phosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDRONEOPTERIN-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydroneopterin 3'-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** plsqmgzyogsoce-xinawcovsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 333.197 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydroneopterin 3'-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=plsqmgzyogsoce-xinawcovsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=333.197}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite DIHYDRONEOPTERIN-P
- common-name:
- 7,8-dihydroneopterin 3'-phosphate
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
- inchi-key:
- plsqmgzyogsoce-xinawcovsa-l
- molecular-weight:
- 333.197
