Difference between revisions of "CPD-8163"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P == * common-name: ** 7,8-dihydroneopterin 3'-phosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-]...")
(Created page with "Category:metabolite == Metabolite CPD-8163 == * common-name: ** 1-16:0-2-18:2-digalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c(...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDRONEOPTERIN-P ==
+
== Metabolite CPD-8163 ==
 
* common-name:
 
* common-name:
** 7,8-dihydroneopterin 3'-phosphate
+
** 1-16:0-2-18:2-digalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
+
** cccccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))coc(=o)ccccccccccccccc)=o
 
* inchi-key:
 
* inchi-key:
** plsqmgzyogsoce-xinawcovsa-l
+
** qzxmupatkglzap-gnspkctrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 333.197
+
** 917.225
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
* [[RXN-8365]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydroneopterin 3'-phosphate}}
+
{{#set: common-name=1-16:0-2-18:2-digalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=plsqmgzyogsoce-xinawcovsa-l}}
+
{{#set: inchi-key=inchikey=qzxmupatkglzap-gnspkctrsa-n}}
{{#set: molecular-weight=333.197}}
+
{{#set: molecular-weight=917.225}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8163

  • common-name:
    • 1-16:0-2-18:2-digalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))coc(=o)ccccccccccccccc)=o
  • inchi-key:
    • qzxmupatkglzap-gnspkctrsa-n
  • molecular-weight:
    • 917.225

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality