Difference between revisions of "CPD-8164"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FRU1P == * common-name: ** β-d-fructofuranose 1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1) * inchi-key: ** rhk...")
(Created page with "Category:metabolite == Metabolite CPD-8164 == * common-name: ** 1-16:0-2-18:3-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FRU1P ==
+
== Metabolite CPD-8164 ==
 
* common-name:
 
* common-name:
** β-d-fructofuranose 1-phosphate
+
** 1-16:0-2-18:3-digalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1)
+
** ccc=ccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))coc(=o)ccccccccccccccc)=o
 
* inchi-key:
 
* inchi-key:
** rhkkzbwrnhgjez-arqdhwqxsa-l
+
** wvwinzzvfafvmj-hzdsjjkasa-n
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 915.209
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8631]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8365]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructofuranose 1-phosphate}}
+
{{#set: common-name=1-16:0-2-18:3-digalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=rhkkzbwrnhgjez-arqdhwqxsa-l}}
+
{{#set: inchi-key=inchikey=wvwinzzvfafvmj-hzdsjjkasa-n}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=915.209}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-8164

  • common-name:
    • 1-16:0-2-18:3-digalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))coc(=o)ccccccccccccccc)=o
  • inchi-key:
    • wvwinzzvfafvmj-hzdsjjkasa-n
  • molecular-weight:
    • 915.209

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality