Difference between revisions of "CPD-8167"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14202 == * common-name: ** l-erythro-7,8-dihydrobiopterin * smiles: ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) * inchi-key: ** femxzdut...")
(Created page with "Category:metabolite == Metabolite CPD-9089 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14202 ==
+
== Metabolite CPD-9089 ==
 +
* smiles:
 +
** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 
* common-name:
 
* common-name:
** l-erythro-7,8-dihydrobiopterin
+
** phyta-2,10,14-trienyl bacteriochlorophyllide a
* smiles:
 
** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n))
 
* inchi-key:
 
** femxzdutfrtwpe-dzswipipsa-n
 
 
* molecular-weight:
 
* molecular-weight:
** 239.233
+
** 906.478
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SEPIAPTERIN-REDUCTASE-RXN]]
+
* [[RXN-8789]]
 +
* [[RXN-8790]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7908]]
+
* [[RXN-8789]]
* [[SEPIAPTERIN-REDUCTASE-RXN]]
+
* [[RXN-8790]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-erythro-7,8-dihydrobiopterin}}
+
{{#set: common-name=phyta-2,10,14-trienyl bacteriochlorophyllide a}}
{{#set: inchi-key=inchikey=femxzdutfrtwpe-dzswipipsa-n}}
+
{{#set: molecular-weight=906.478}}
{{#set: molecular-weight=239.233}}
 

Revision as of 11:18, 15 January 2021

Metabolite CPD-9089

  • smiles:
    • ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
  • common-name:
    • phyta-2,10,14-trienyl bacteriochlorophyllide a
  • molecular-weight:
    • 906.478

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality