Difference between revisions of "CPD-8167"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6377 RXN0-6377] == * direction: ** left-to-right * common-name: ** nitrite reductase [nad(p)h]...")
(Created page with "Category:metabolite == Metabolite CPD-8167 == * common-name: ** 1-18:3-2-18:2-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6377 RXN0-6377] ==
+
== Metabolite CPD-8167 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** nitrite reductase [nad(p)h]
+
** 1-18:3-2-18:2-monogalactosyldiacylglycerol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.7.1.4 ec-1.7.1.4]
+
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
−
== Reaction formula ==
+
* inchi-key:
−
* 3 [[NADH-P-OR-NOP]][c] '''+''' 1 [[NITRITE]][c] '''+''' 5 [[PROTON]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 3 [[NAD-P-OR-NOP]][c] '''+''' 2 [[WATER]][c]
+
** ynsrhgcgbfcdgk-rouqbacdsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ21568]]
+
** 777.089
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ11978]]
+
* [[RXN-8366]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=1-18:3-2-18:2-monogalactosyldiacylglycerol}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=ynsrhgcgbfcdgk-rouqbacdsa-n}}
−
* [[PWY-723]], alkylnitronates degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-723 PWY-723]
+
{{#set: molecular-weight=777.089}}
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-5675]], nitrate reduction V (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5675 PWY-5675]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24630 24630]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=nitrite reductase [nad(p)h]}}
 
−
{{#set: ec-number=ec-1.7.1.4}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-8167

  • common-name:
    • 1-18:3-2-18:2-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
  • inchi-key:
    • ynsrhgcgbfcdgk-rouqbacdsa-n
  • molecular-weight:
    • 777.089

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8167&oldid=139162"