Difference between revisions of "CPD-8167"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA-DECARBOXYLASE-RXN MALONYL-COA-DECARBOXYLASE-RXN] == * direction: ** left-to-right * ec-...")
(Created page with "Category:metabolite == Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ == * common-name: ** vitamin k 2,3-epoxide * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA-DECARBOXYLASE-RXN MALONYL-COA-DECARBOXYLASE-RXN] ==
+
== Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** vitamin k 2,3-epoxide
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.1.9 ec-4.1.1.9]
+
** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
** kutxfbihpwidjq-hbdfacptsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ04089]]
+
** 466.703
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[1.1.4.1-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[1.1.4.1-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=vitamin k 2,3-epoxide}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=466.703}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18782 18782]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00233 R00233]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P12617 P12617]
 
−
** [http://www.uniprot.org/uniprot/Q54112 Q54112]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-4.1.1.9}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ

  • common-name:
    • vitamin k 2,3-epoxide
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
  • inchi-key:
    • kutxfbihpwidjq-hbdfacptsa-n
  • molecular-weight:
    • 466.703

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8167&oldid=47978"