Difference between revisions of "CPD-8167"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ == * common-name: ** vitamin k 2,3-epoxide * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c...")
(Created page with "Category:metabolite == Metabolite Semiquinones == * common-name: ** a semiquinone == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ ==
+
== Metabolite Semiquinones ==
 
* common-name:
 
* common-name:
** vitamin k 2,3-epoxide
+
** a semiquinone
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
 
* inchi-key:
 
** kutxfbihpwidjq-hbdfacptsa-n
 
* molecular-weight:
 
** 466.703
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.4.1-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.4.1-RXN]]
+
* [[QOR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=vitamin k 2,3-epoxide}}
+
{{#set: common-name=a semiquinone}}
{{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}}
 
{{#set: molecular-weight=466.703}}
 

Revision as of 14:59, 5 January 2021

Metabolite Semiquinones

  • common-name:
    • a semiquinone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality