Difference between revisions of "CPD-8202"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19157 == * common-name: ** 3-oxo-(7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite CPD-8202 == * common-name: ** a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine == Reaction(s) known to consume...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19157 ==
+
== Metabolite CPD-8202 ==
 
* common-name:
 
* common-name:
** 3-oxo-(7z)-tetradecenoyl-coa
+
** a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine
* smiles:
 
** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** bepllrgjvxaeji-twafkmgksa-j
 
* molecular-weight:
 
** 985.829
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17795]]
+
* [[2.4.1.134-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17794]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(7z)-tetradecenoyl-coa}}
+
{{#set: common-name=a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine}}
{{#set: inchi-key=inchikey=bepllrgjvxaeji-twafkmgksa-j}}
 
{{#set: molecular-weight=985.829}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8202

  • common-name:
    • a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-3-o-(β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.