Difference between revisions of "CPD-8202"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * smiles: ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** fpipgxgpppqfeq-ovs...") |
(Created page with "Category:metabolite == Metabolite OXALATE == * common-name: ** oxalate * smiles: ** c([o-])(c(=o)[o-])=o * inchi-key: ** mubzpkhoepujkr-uhfffaoysa-l * molecular-weight: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OXALATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** oxalate |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(c(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mubzpkhoepujkr-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 88.02 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[OXALATE-DECARBOXYLASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GLYOXYLATE-OXIDASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=oxalate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mubzpkhoepujkr-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=88.02}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite OXALATE
- common-name:
- oxalate
- smiles:
- c([o-])(c(=o)[o-])=o
- inchi-key:
- mubzpkhoepujkr-uhfffaoysa-l
- molecular-weight:
- 88.02
