Difference between revisions of "CPD-824"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12178 RXN-12178] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-824 == * common-name: ** 5-guanidino-2-oxopentanoate * smiles: ** c(c(cccnc(=[n+])n)=o)(=o)[o-] * inchi-key: ** arbhxjxxvvhmet-uhfffa...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-824 == |
− | * | + | * common-name: |
− | ** | + | ** 5-guanidino-2-oxopentanoate |
− | * | + | * smiles: |
− | ** | + | ** c(c(cccnc(=[n+])n)=o)(=o)[o-] |
− | + | * inchi-key: | |
− | + | ** arbhxjxxvvhmet-uhfffaoysa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 173.171 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[ARG-OXIDATION-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=5-guanidino-2-oxopentanoate}} | |
− | + | {{#set: inchi-key=inchikey=arbhxjxxvvhmet-uhfffaoysa-n}} | |
− | + | {{#set: molecular-weight=173.171}} | |
− | |||
− | * | ||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-824
- common-name:
- 5-guanidino-2-oxopentanoate
- smiles:
- c(c(cccnc(=[n+])n)=o)(=o)[o-]
- inchi-key:
- arbhxjxxvvhmet-uhfffaoysa-n
- molecular-weight:
- 173.171