Difference between revisions of "CPD-824"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBNOm HBNOm] == * direction: ** reversible * common-name: ** 3-hydroxybutanoate:nad+ oxidoreductase...") |
(Created page with "Category:metabolite == Metabolite CPD-824 == * common-name: ** 5-guanidino-2-oxopentanoate * smiles: ** c(c(cccnc(=[n+])n)=o)(=o)[o-] * inchi-key: ** arbhxjxxvvhmet-uhfffa...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-824 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 5-guanidino-2-oxopentanoate |
| − | + | * smiles: | |
| − | + | ** c(c(cccnc(=[n+])n)=o)(=o)[o-] | |
| − | + | * inchi-key: | |
| − | + | ** arbhxjxxvvhmet-uhfffaoysa-n | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 173.171 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[ARG-OXIDATION-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=5-guanidino-2-oxopentanoate}} | |
| − | * | + | {{#set: inchi-key=inchikey=arbhxjxxvvhmet-uhfffaoysa-n}} |
| − | ** | + | {{#set: molecular-weight=173.171}} |
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | == | ||
| − | * | ||
| − | == | ||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-824
- common-name:
- 5-guanidino-2-oxopentanoate
- smiles:
- c(c(cccnc(=[n+])n)=o)(=o)[o-]
- inchi-key:
- arbhxjxxvvhmet-uhfffaoysa-n
- molecular-weight:
- 173.171
