Difference between revisions of "CPD-824"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18490 == * common-name: ** (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccccc=cc(sccnc...")
(Created page with "Category:metabolite == Metabolite N-terminal-specific-UCP-E2-L-cysteine == * common-name: ** an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine == Reaction(s) know...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18490 ==
+
== Metabolite N-terminal-specific-UCP-E2-L-cysteine ==
 
* common-name:
 
* common-name:
** (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa
+
** an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** avrcofdawhwkmb-mnthwfihsa-j
 
* molecular-weight:
 
** 1104.05
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15563]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17110]]
+
* [[RXN-15564]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa}}
+
{{#set: common-name=an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine}}
{{#set: inchi-key=inchikey=avrcofdawhwkmb-mnthwfihsa-j}}
 
{{#set: molecular-weight=1104.05}}
 

Revision as of 14:59, 5 January 2021

Metabolite N-terminal-specific-UCP-E2-L-cysteine

  • common-name:
    • an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.