Difference between revisions of "CPD-8259"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-ubiquitinyl-UCP-E2-L-cysteine == * common-name: ** an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine == Reaction(s) known t...")
(Created page with "Category:metabolite == Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE == * common-name: ** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole * smiles: ** c(op([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-ubiquitinyl-UCP-E2-L-cysteine ==
+
== Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE ==
 
* common-name:
 
* common-name:
** an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine
+
** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
 +
* smiles:
 +
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
 +
* inchi-key:
 +
** naqghjtuzrhgac-lbgugvgysa-j
 +
* molecular-weight:
 +
** 450.255
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15559]]
+
* [[AIAL]]
* [[RXN-15561]]
+
* [[AICARSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15556]]
+
* [[AIAL]]
 +
* [[AICARSYN-RXN]]
 +
* [[SAICARSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine}}
+
{{#set: common-name=5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole}}
 +
{{#set: inchi-key=inchikey=naqghjtuzrhgac-lbgugvgysa-j}}
 +
{{#set: molecular-weight=450.255}}

Revision as of 08:24, 15 March 2021

Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE

  • common-name:
    • 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
  • smiles:
    • c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
  • inchi-key:
    • naqghjtuzrhgac-lbgugvgysa-j
  • molecular-weight:
    • 450.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality