Difference between revisions of "CPD-8259"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine == * common-name: ** a [dna ligase]-l-lysine == Reaction(s) known to consume the compound == * RXN-17917 * RXN-...")
(Created page with "Category:metabolite == Metabolite CPD-8259 == * common-name: ** β-d-ribosylnicotinate * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) * inchi-key: ** pu...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DNA-Ligase-L-lysine ==
+
== Metabolite CPD-8259 ==
 
* common-name:
 
* common-name:
** a [dna ligase]-l-lysine
+
** β-d-ribosylnicotinate
 +
* smiles:
 +
** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
 +
* inchi-key:
 +
** pueddpcucprqny-zyuzmqfosa-n
 +
* molecular-weight:
 +
** 255.227
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17917]]
+
* [[RXN-8443]]
* [[RXN-17920]]
 
* [[RXN-17921]]
 
* [[RXN-17924]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17918]]
+
* [[RXN-14227]]
* [[RXN-17922]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [dna ligase]-l-lysine}}
+
{{#set: common-name=β-d-ribosylnicotinate}}
 +
{{#set: inchi-key=inchikey=pueddpcucprqny-zyuzmqfosa-n}}
 +
{{#set: molecular-weight=255.227}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-8259

  • common-name:
    • β-d-ribosylnicotinate
  • smiles:
    • c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
  • inchi-key:
    • pueddpcucprqny-zyuzmqfosa-n
  • molecular-weight:
    • 255.227

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality