Difference between revisions of "CPD-8259"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine == * common-name: ** a [dna ligase]-l-lysine == Reaction(s) known to consume the compound == * RXN-17917 * RXN-...") |
(Created page with "Category:metabolite == Metabolite CPD-8259 == * common-name: ** β-d-ribosylnicotinate * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) * inchi-key: ** pu...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8259 == |
* common-name: | * common-name: | ||
− | ** | + | ** β-d-ribosylnicotinate |
+ | * smiles: | ||
+ | ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) | ||
+ | * inchi-key: | ||
+ | ** pueddpcucprqny-zyuzmqfosa-n | ||
+ | * molecular-weight: | ||
+ | ** 255.227 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-8443]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14227]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=β-d-ribosylnicotinate}} |
+ | {{#set: inchi-key=inchikey=pueddpcucprqny-zyuzmqfosa-n}} | ||
+ | {{#set: molecular-weight=255.227}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-8259
- common-name:
- β-d-ribosylnicotinate
- smiles:
- c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
- inchi-key:
- pueddpcucprqny-zyuzmqfosa-n
- molecular-weight:
- 255.227