Difference between revisions of "CPD-8259"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03419 == * transcription-direction: ** positive * right-end-position: ** 61954 * left-end-position: ** 47501 * centisome-position: ** 39.162838...")
(Created page with "Category:metabolite == Metabolite CPD-8259 == * common-name: ** β-d-ribosylnicotinate * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) * inchi-key: ** pu...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03419 ==
+
== Metabolite CPD-8259 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** β-d-ribosylnicotinate
−
* right-end-position:
+
* smiles:
−
** 61954
+
** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
−
* left-end-position:
+
* inchi-key:
−
** 47501
+
** pueddpcucprqny-zyuzmqfosa-n
−
* centisome-position:
+
* molecular-weight:
−
** 39.162838   
+
** 255.227
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8443]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
+
* [[RXN-14227]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=β-d-ribosylnicotinate}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=pueddpcucprqny-zyuzmqfosa-n}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=255.227}}
−
== Pathway(s) associated ==
 
−
* [[UDPNACETYLGALSYN-PWY]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[UDPNAGSYN-PWY]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6749]]
 
−
** '''1''' reactions found over '''10''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=61954}}
 
−
{{#set: left-end-position=47501}}
 
−
{{#set: centisome-position=39.162838    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-8259

  • common-name:
    • β-d-ribosylnicotinate
  • smiles:
    • c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
  • inchi-key:
    • pueddpcucprqny-zyuzmqfosa-n
  • molecular-weight:
    • 255.227

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8259&oldid=136786"