Difference between revisions of "CPD-8268"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16932 == * transcription-direction: ** negative * right-end-position: ** 268373 * left-end-position: ** 253416 * centisome-position: ** 37.157608...")
(Created page with "Category:metabolite == Metabolite CPD-8268 == * common-name: ** dioleoyl phosphatidate * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o *...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16932 ==
+
== Metabolite CPD-8268 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** dioleoyl phosphatidate
−
* right-end-position:
+
* smiles:
−
** 268373
+
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 253416
+
** mhuwzntuiifhas-dssvuwshsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 37.157608   
+
** 698.959
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-15068]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-15043]]
−
* [[3.4.11.18-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=dioleoyl phosphatidate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=mhuwzntuiifhas-dssvuwshsa-l}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=698.959}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17873]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17874]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17875]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17876]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17877]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17878]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7800]]
 
−
** '''6''' reactions found over '''21''' reactions in the full pathway
 
−
* [[PWY-7799]]
 
−
** '''7''' reactions found over '''14''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=268373}}
 
−
{{#set: left-end-position=253416}}
 
−
{{#set: centisome-position=37.157608    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8268

  • common-name:
    • dioleoyl phosphatidate
  • smiles:
    • ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
  • inchi-key:
    • mhuwzntuiifhas-dssvuwshsa-l
  • molecular-weight:
    • 698.959

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8268&oldid=137850"