Difference between revisions of "CPD-8291"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-431 == * common-name: ** apigenin * smiles: ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3))) * inchi-key: ** kznifhplkgyrtm-u...")
(Created page with "Category:metabolite == Metabolite CPD-8291 == * common-name: ** 1-18:1-2-18:1-phosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(oc...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-431 ==
+
== Metabolite CPD-8291 ==
 
* common-name:
 
* common-name:
** apigenin
+
** 1-18:1-2-18:1-phosphatidylethanolamine
 
* smiles:
 
* smiles:
** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3)))
+
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o
 
* inchi-key:
 
* inchi-key:
** kznifhplkgyrtm-uhfffaoysa-m
+
** mwrbnpkjoowzpw-nyvomtagsa-n
 
* molecular-weight:
 
* molecular-weight:
** 269.233
+
** 744.043
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7651]]
+
* [[RXN-15036]]
 +
* [[RXN-15067]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15036]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=apigenin}}
+
{{#set: common-name=1-18:1-2-18:1-phosphatidylethanolamine}}
{{#set: inchi-key=inchikey=kznifhplkgyrtm-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=mwrbnpkjoowzpw-nyvomtagsa-n}}
{{#set: molecular-weight=269.233}}
+
{{#set: molecular-weight=744.043}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-8291

  • common-name:
    • 1-18:1-2-18:1-phosphatidylethanolamine
  • smiles:
    • ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o
  • inchi-key:
    • mwrbnpkjoowzpw-nyvomtagsa-n
  • molecular-weight:
    • 744.043

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality