Difference between revisions of "CPD-8343"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9038 == * common-name: ** precorrin-1 * smiles: ** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc...")
(Created page with "Category:metabolite == Metabolite CPD-8343 == * common-name: ** 1-16:0-2-lysophosphatidylcholine * smiles: ** cccccccccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * inchi...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9038 ==
+
== Metabolite CPD-8343 ==
 
* common-name:
 
* common-name:
** precorrin-1
+
** 1-16:0-2-lysophosphatidylcholine
 
* smiles:
 
* smiles:
** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
+
** cccccccccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
* inchi-key:
** cjlvuwulfkhgfb-nzcajupmsa-f
+
** aswbnkhczgqvjv-hszrjfapsa-n
 
* molecular-weight:
 
* molecular-weight:
** 842.768
+
** 495.635
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8675]]
+
* [[RXN-15066]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UROPORIIIMETHYLTRANSA-RXN]]
+
* [[RXN-15065]]
 +
* [[RXN-15066]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=precorrin-1}}
+
{{#set: common-name=1-16:0-2-lysophosphatidylcholine}}
{{#set: inchi-key=inchikey=cjlvuwulfkhgfb-nzcajupmsa-f}}
+
{{#set: inchi-key=inchikey=aswbnkhczgqvjv-hszrjfapsa-n}}
{{#set: molecular-weight=842.768}}
+
{{#set: molecular-weight=495.635}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-8343

  • common-name:
    • 1-16:0-2-lysophosphatidylcholine
  • smiles:
    • cccccccccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • aswbnkhczgqvjv-hszrjfapsa-n
  • molecular-weight:
    • 495.635

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality