Difference between revisions of "CPD-8343"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5289 RXN0-5289] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/1.1...") |
(Created page with "Category:metabolite == Metabolite CHORISMATE == * common-name: ** chorismate * smiles: ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) * inchi-key: ** wtfxtqvdakgdey-htqzyqbo...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CHORISMATE == |
| − | * | + | * common-name: |
| − | ** | + | ** chorismate |
| − | * | + | * smiles: |
| − | ** | + | ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) |
| − | == | + | * inchi-key: |
| − | + | ** wtfxtqvdakgdey-htqzyqbosa-l | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 224.17 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[ANTHRANSYN-RXN]] |
| − | == | + | * [[CHORISMATEMUT-RXN]] |
| − | * [[ | + | * [[ISOCHORSYN-RXN]] |
| − | * | + | * [[PABASYN-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[ANTHRANSYN-RXN]] | |
| − | == | + | * [[CHORISMATE-SYNTHASE-RXN]] |
| − | + | * [[CHORISMATEMUT-RXN]] | |
| − | + | * [[ISOCHORSYN-RXN]] | |
| − | + | * [[PABASYN-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=chorismate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=wtfxtqvdakgdey-htqzyqbosa-l}} |
| − | {{#set: | + | {{#set: molecular-weight=224.17}} |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite CHORISMATE
- common-name:
- chorismate
- smiles:
- c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
- inchi-key:
- wtfxtqvdakgdey-htqzyqbosa-l
- molecular-weight:
- 224.17
