Difference between revisions of "CPD-8347"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORHODOPSIN == * common-name: ** a phosphorhodopsin == Reaction(s) known to consume the compound == * 2.7.11.14-RXN == Reaction(...") |
(Created page with "Category:metabolite == Metabolite CPD-8347 == * common-name: ** 1-18:2-2-lysophosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * i...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8347 == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-18:2-2-lysophosphatidylcholine |
+ | * smiles: | ||
+ | ** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o | ||
+ | * inchi-key: | ||
+ | ** spjfyyjxnpezdw-ftjopakqsa-n | ||
+ | * molecular-weight: | ||
+ | ** 519.657 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12430]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-18:2-2-lysophosphatidylcholine}} |
+ | {{#set: inchi-key=inchikey=spjfyyjxnpezdw-ftjopakqsa-n}} | ||
+ | {{#set: molecular-weight=519.657}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-8347
- common-name:
- 1-18:2-2-lysophosphatidylcholine
- smiles:
- cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- spjfyyjxnpezdw-ftjopakqsa-n
- molecular-weight:
- 519.657