Difference between revisions of "CPD-8347"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12529 == * transcription-direction: ** positive * right-end-position: ** 93783 * left-end-position: ** 84310 * centisome-position: ** 23.567461...")
(Created page with "Category:metabolite == Metabolite CPD-8347 == * common-name: ** 1-18:2-2-lysophosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * i...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12529 ==
+
== Metabolite CPD-8347 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1-18:2-2-lysophosphatidylcholine
−
* right-end-position:
+
* smiles:
−
** 93783
+
** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
−
* left-end-position:
+
* inchi-key:
−
** 84310
+
** spjfyyjxnpezdw-ftjopakqsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 23.567461   
+
** 519.657
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-12430]]
−
* [[1TRANSKETO-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=1-18:2-2-lysophosphatidylcholine}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=spjfyyjxnpezdw-ftjopakqsa-n}}
−
* [[2TRANSKETO-RXN]]
+
{{#set: molecular-weight=519.657}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[DXS-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[P124-PWY]]
 
−
** '''12''' reactions found over '''15''' reactions in the full pathway
 
−
* [[CALVIN-PWY]]
 
−
** '''12''' reactions found over '''13''' reactions in the full pathway
 
−
* [[P185-PWY]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-1861]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[P21-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[NONOXIPENT-PWY]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5723]]
 
−
** '''10''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6901]]
 
−
** '''10''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-6891]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6892]]
 
−
** '''5''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PYRIDOXSYN-PWY]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[NONMEVIPP-PWY]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7560]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=93783}}
 
−
{{#set: left-end-position=84310}}
 
−
{{#set: centisome-position=23.567461    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=13}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8347

  • common-name:
    • 1-18:2-2-lysophosphatidylcholine
  • smiles:
    • cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • spjfyyjxnpezdw-ftjopakqsa-n
  • molecular-weight:
    • 519.657

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8347&oldid=137844"