Difference between revisions of "CPD-8347"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Rubisco-trimethylated-lysine == * common-name: ** a [ribulose-1,5-bisphosphate-carboxylase]-n6,n6,n6-trimethyl-l-lysine == Reaction(s) kn...")
(Created page with "Category:metabolite == Metabolite CPD-8347 == * common-name: ** 1-18:2-2-lysophosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * i...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Rubisco-trimethylated-lysine ==
+
== Metabolite CPD-8347 ==
 
* common-name:
 
* common-name:
** a [ribulose-1,5-bisphosphate-carboxylase]-n6,n6,n6-trimethyl-l-lysine
+
** 1-18:2-2-lysophosphatidylcholine
 +
* smiles:
 +
** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
 +
* inchi-key:
 +
** spjfyyjxnpezdw-ftjopakqsa-n
 +
* molecular-weight:
 +
** 519.657
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.127-RXN]]
+
* [[RXN-12430]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [ribulose-1,5-bisphosphate-carboxylase]-n6,n6,n6-trimethyl-l-lysine}}
+
{{#set: common-name=1-18:2-2-lysophosphatidylcholine}}
 +
{{#set: inchi-key=inchikey=spjfyyjxnpezdw-ftjopakqsa-n}}
 +
{{#set: molecular-weight=519.657}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8347

  • common-name:
    • 1-18:2-2-lysophosphatidylcholine
  • smiles:
    • cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • spjfyyjxnpezdw-ftjopakqsa-n
  • molecular-weight:
    • 519.657

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality