Difference between revisions of "CPD-8355"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05950 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-5464 ** Category:...") |
(Created page with "Category:metabolite == Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- == * common-name: ** udp-β-l-threo-pentapyranos-4-ulose * smiles: ** c3(oc(op(=o)([o-])op(=o)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- == |
− | = | + | * common-name: |
− | + | ** udp-β-l-threo-pentapyranos-4-ulose | |
− | == | + | * smiles: |
− | * | + | ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(=o)3) |
− | ** | + | * inchi-key: |
− | *** | + | ** urjziqltpcjvmw-qnsckltrsa-l |
− | == | + | * molecular-weight: |
− | * [[ | + | ** 532.247 |
− | + | == Reaction(s) known to consume the compound == | |
− | {{#set: | + | * [[RXN0-1863]] |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | {{#set: | + | * [[RXN0-1863]] |
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=udp-β-l-threo-pentapyranos-4-ulose}} | ||
+ | {{#set: inchi-key=inchikey=urjziqltpcjvmw-qnsckltrsa-l}} | ||
+ | {{#set: molecular-weight=532.247}} |
Revision as of 20:32, 18 December 2020
Contents
Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE-
- common-name:
- udp-β-l-threo-pentapyranos-4-ulose
- smiles:
- c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(=o)3)
- inchi-key:
- urjziqltpcjvmw-qnsckltrsa-l
- molecular-weight:
- 532.247