|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ06882 == | + | == Metabolite TRYPTAMINE == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** tryptamine |
| − | * right-end-position: | + | * smiles: |
| − | ** 362793
| + | ** c([n+])cc1(=cnc2(c=cc=cc1=2)) |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 349863
| + | ** apjydqyyacxcrm-uhfffaoysa-o |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 74.659256 | + | ** 161.226 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[RXN-1401]] |
| − | == Reaction(s) associated == | + | * [[STRICTOSIDINE-SYNTHASE-RXN]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to produce the compound == |
| − | * [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]] | + | * [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) of unknown directionality == |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | + | {{#set: common-name=tryptamine}} |
| − | * [[RXN-11750]]
| + | {{#set: inchi-key=inchikey=apjydqyyacxcrm-uhfffaoysa-o}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=161.226}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-12969]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-13001]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-13302]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-13303]] | |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-13304]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-13305]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-13444]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14485]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14494]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-16021]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-16096]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-16113]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-16130]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-16155]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-17110]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-5080]]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7592]]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5353]]
| |
| − | ** '''7''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7724]]
| |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7619]]
| |
| − | ** '''3''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7602]]
| |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7036]]
| |
| − | ** '''14''' reactions found over '''16''' reactions in the full pathway
| |
| − | * [[PWY-7053]]
| |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7606]]
| |
| − | ** '''8''' reactions found over '''14''' reactions in the full pathway
| |
| − | * [[PWY-7727]]
| |
| − | ** '''2''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6433]]
| |
| − | ** '''17''' reactions found over '''22''' reactions in the full pathway
| |
| − | * [[PWY-6958]]
| |
| − | ** '''5''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7049]]
| |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7725]]
| |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6598]]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7601]]
| |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7726]]
| |
| − | ** '''8''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-7728]]
| |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=362793}} | |
| − | {{#set: left-end-position=349863}}
| |
| − | {{#set: centisome-position=74.659256 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=17}}
| |
| − | {{#set: nb pathway associated=18}}
| |
