Difference between revisions of "CPD-845"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17372 == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o *...") |
(Created page with "Category:metabolite == Metabolite Cytidine-32-tRNAs == * common-name: ** a cytidine 32 in trna == Reaction(s) known to consume the compound == * RXN-11866 == Reaction(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Cytidine-32-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cytidine 32 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11866]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cytidine 32 in trna}} |
| − | |||
| − | |||
Revision as of 18:56, 14 January 2021
Contents
Metabolite Cytidine-32-tRNAs
- common-name:
- a cytidine 32 in trna
