Difference between revisions of "CPD-8462"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-P-PANTOTHENATE == * common-name: ** (r)-4'-phosphopantothenate * smiles: ** cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-8462 == * common-name: ** pentadecanoate * smiles: ** ccccccccccccccc([o-])=o * inchi-key: ** wqepluugtldzjy-uhfffaoysa-m * molecular...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8462 == |
* common-name: | * common-name: | ||
| − | ** | + | ** pentadecanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccccccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wqepluugtldzjy-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 241.393 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pentadecanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wqepluugtldzjy-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=241.393}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-8462
- common-name:
- pentadecanoate
- smiles:
- ccccccccccccccc([o-])=o
- inchi-key:
- wqepluugtldzjy-uhfffaoysa-m
- molecular-weight:
- 241.393
