Difference between revisions of "CPD-8490"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Glycogens == * common-name: ** a glycogen == Reaction(s) known to consume the compound == * GLYCOPHOSPHORYL-RXN * GLYMALTOPHOSPHORY...") |
(Created page with "Category:metabolite == Metabolite DEOXYURIDINE == * common-name: ** 2'-deoxyuridine * smiles: ** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) * inchi-key: ** mxhrcpnrjammim-shyze...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEOXYURIDINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2'-deoxyuridine |
| + | * smiles: | ||
| + | ** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) | ||
| + | * inchi-key: | ||
| + | ** mxhrcpnrjammim-shyzeuofsa-n | ||
| + | * molecular-weight: | ||
| + | ** 228.204 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[URA-PHOSPH-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[CYTIDEAM-RXN]] | ||
| + | * [[RXN-14143]] | ||
| + | * [[URA-PHOSPH-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2'-deoxyuridine}} |
| + | {{#set: inchi-key=inchikey=mxhrcpnrjammim-shyzeuofsa-n}} | ||
| + | {{#set: molecular-weight=228.204}} | ||
Revision as of 15:28, 5 January 2021
Contents
Metabolite DEOXYURIDINE
- common-name:
- 2'-deoxyuridine
- smiles:
- c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
- inchi-key:
- mxhrcpnrjammim-shyzeuofsa-n
- molecular-weight:
- 228.204
