Difference between revisions of "CPD-8550"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETOACETYL-COA == * common-name: ** acetoacetyl-coa * smiles: ** cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(...")
(Created page with "Category:metabolite == Metabolite CPD-23708 == * common-name: ** (3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-24-en-3-ol * inchi-key: ** ghmalmmxv...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETOACETYL-COA ==
+
== Metabolite CPD-23708 ==
 
* common-name:
 
* common-name:
** acetoacetyl-coa
+
** (3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-24-en-3-ol
* smiles:
 
** cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
* inchi-key:
 
* inchi-key:
** ojfdkhtzouzbos-citakdkdsa-j
+
** ghmalmmxvubofv-twoguosysa-m
 
* molecular-weight:
 
* molecular-weight:
** 847.577
+
** 455.699
 +
* smiles:
 +
** cc(c)=ccc[c@@h](c)[c@h]3(cc[c@@]4(c)([c@@h]1(cc[c@h]5([c@@](c([o-])=o)(c)[c@@h](o)cc[c@@]2(c[c@@]12cc[c@](c)34)5))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
+
* [[RXN-21830]]
* [[ACACT1h]]
 
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 
* [[HACD1h]]
 
* [[HBCO_LPAREN_nadp_RPAREN_]]
 
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 
* [[RXN-11662]]
 
* [[RXN-5901]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACACT]]
+
* [[RXN-21829]]
* [[ACACT1h]]
 
* [[ACETOACETATE--COA-LIGASE-RXN]]
 
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 
* [[HACD1h]]
 
* [[HBCO]]
 
* [[HBCO_LPAREN_nadp_RPAREN_]]
 
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 
* [[RXN-11662]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=acetoacetyl-coa}}
+
{{#set: common-name=(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-24-en-3-ol}}
{{#set: inchi-key=inchikey=ojfdkhtzouzbos-citakdkdsa-j}}
+
{{#set: inchi-key=inchikey=ghmalmmxvubofv-twoguosysa-m}}
{{#set: molecular-weight=847.577}}
+
{{#set: molecular-weight=455.699}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-23708

  • common-name:
    • (3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-24-en-3-ol
  • inchi-key:
    • ghmalmmxvubofv-twoguosysa-m
  • molecular-weight:
    • 455.699
  • smiles:
    • cc(c)=ccc[c@@h](c)[c@h]3(cc[c@@]4(c)([c@@h]1(cc[c@h]5([c@@](c([o-])=o)(c)[c@@h](o)cc[c@@]2(c[c@@]12cc[c@](c)34)5))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality