Difference between revisions of "CPD-8550"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2189 == * common-name: ** 1-18:2-2-16:2-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
(Created page with "Category:metabolite == Metabolite CPD-8550 == * common-name: ** a substituted β-amino acid == Reaction(s) known to consume the compound == == Reaction(s) known to pro...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-2189 ==
+
== Metabolite CPD-8550 ==
 
* common-name:
 
* common-name:
** 1-18:2-2-16:2-monogalactosyldiacylglycerol
+
** a substituted β-amino acid
* smiles:
 
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 
* inchi-key:
 
** djvqakqvqxihel-uilgywmgsa-n
 
* molecular-weight:
 
** 751.052
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8299]]
 
* [[RXN-8306]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[BETA-LACTAMASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-16:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=a substituted β-amino acid}}
{{#set: inchi-key=inchikey=djvqakqvqxihel-uilgywmgsa-n}}
 
{{#set: molecular-weight=751.052}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-8550

  • common-name:
    • a substituted β-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality