Difference between revisions of "CPD-8550"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-vifpvbqesa-n *...") |
(Created page with "Category:metabolite == Metabolite CPD-8550 == * common-name: ** a substituted β-amino acid == Reaction(s) known to consume the compound == == Reaction(s) known to pro...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8550 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a substituted β-amino acid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[BETA-LACTAMASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a substituted β-amino acid}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-8550
- common-name:
- a substituted β-amino acid
