Difference between revisions of "CPD-8550"

Revision as of 15:30, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-2189 ==
+== Metabolite TRP ==
 * common-name:
-** 1-18:2-2-16:2-monogalactosyldiacylglycerol
+** l-tryptophan
 * smiles:
-** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
+** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
 * inchi-key:
-** djvqakqvqxihel-uilgywmgsa-n
+** qivbcdijiajpqs-vifpvbqesa-n
 * molecular-weight:
-** 751.052
+** 204.228
 == Reaction(s) known to consume the compound ==
-* [[RXN-8299]]
+* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
-* [[RXN-8306]]
+* [[RXN-8665]]
+* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
+* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
+* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
+* [[RXN0-2382]]
+* [[TRYPSYN-RXN]]
+* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-18:2-2-16:2-monogalactosyldiacylglycerol}}
+{{#set: common-name=l-tryptophan}}
-{{#set: inchi-key=inchikey=djvqakqvqxihel-uilgywmgsa-n}}
+{{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}}
-{{#set: molecular-weight=751.052}}
+{{#set: molecular-weight=204.228}}