Difference between revisions of "CPD-8606"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16475 == * common-name: ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite CPD-8606 == * common-name: ** 24,25-dihydrolanosterol * smiles: ** cc(c)cccc([ch]4(c1(c)(c(c)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))c...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16475 ==
+
== Metabolite CPD-8606 ==
 
* common-name:
 
* common-name:
** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine
+
** 24,25-dihydrolanosterol
 
* smiles:
 
* smiles:
** cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3)
+
** cc(c)cccc([ch]4(c1(c)(c(c)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c
 
* inchi-key:
 
* inchi-key:
** hbbozfuqjdyasd-qgtnpelvsa-n
+
** mbzykevpfyhdoh-bqniitsrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 529.494
+
** 428.74
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15268]]
+
* [[RXN-13707]]
 +
* [[RXN66-11]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15268]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine}}
+
{{#set: common-name=24,25-dihydrolanosterol}}
{{#set: inchi-key=inchikey=hbbozfuqjdyasd-qgtnpelvsa-n}}
+
{{#set: inchi-key=inchikey=mbzykevpfyhdoh-bqniitsrsa-n}}
{{#set: molecular-weight=529.494}}
+
{{#set: molecular-weight=428.74}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-8606

  • common-name:
    • 24,25-dihydrolanosterol
  • smiles:
    • cc(c)cccc([ch]4(c1(c)(c(c)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c
  • inchi-key:
    • mbzykevpfyhdoh-bqniitsrsa-n
  • molecular-weight:
    • 428.74

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality