Difference between revisions of "CPD-8606"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15510 RXN-15510] == * direction: ** reversible == Reaction formula == * 1 2-PG[c] '''+''' 1...") |
(Created page with "Category:metabolite == Metabolite CPD-16475 == * common-name: ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-16475 == |
| − | * | + | * common-name: |
| − | ** | + | ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine |
| − | + | * smiles: | |
| − | + | ** cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3) | |
| − | + | * inchi-key: | |
| − | + | ** hbbozfuqjdyasd-qgtnpelvsa-n | |
| − | + | * molecular-weight: | |
| − | + | ** 529.494 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-15268]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[RXN-15268]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine}} | |
| − | * | + | {{#set: inchi-key=inchikey=hbbozfuqjdyasd-qgtnpelvsa-n}} |
| − | ** | + | {{#set: molecular-weight=529.494}} |
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | * | ||
| − | == | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-16475
- common-name:
- β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine
- smiles:
- cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3)
- inchi-key:
- hbbozfuqjdyasd-qgtnpelvsa-n
- molecular-weight:
- 529.494
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
