Difference between revisions of "CPD-8607"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2K-ADIPATE == * common-name: ** 2-oxoadipate * smiles: ** c(cc(=o)c(=o)[o-])cc(=o)[o-] * inchi-key: ** fgsbnbbhozhubo-uhfffaoysa-l * mole...") |
(Created page with "Category:metabolite == Metabolite CANAVANINE == * common-name: ** l-canavanine * smiles: ** c(cc([n+])c(=o)[o-])onc(=[n+])n * inchi-key: ** fsbigdsbmbyopn-vkhmyheasa-o * m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CANAVANINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-canavanine |
* smiles: | * smiles: | ||
| − | ** c(cc( | + | ** c(cc([n+])c(=o)[o-])onc(=[n+])n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fsbigdsbmbyopn-vkhmyheasa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 177.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-34]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-22]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-canavanine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fsbigdsbmbyopn-vkhmyheasa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=177.183}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CANAVANINE
- common-name:
- l-canavanine
- smiles:
- c(cc([n+])c(=o)[o-])onc(=[n+])n
- inchi-key:
- fsbigdsbmbyopn-vkhmyheasa-o
- molecular-weight:
- 177.183
