Difference between revisions of "CPD-8608"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THFOR2 THFOR2] == * direction: ** left-to-right * common-name: ** 5,6,7,8-tetrahydrofolate:nadp+ ox...")
(Created page with "Category:metabolite == Metabolite 7-METHYLXANTHINE == * common-name: ** 7-methylxanthine * smiles: ** cn1(c=nc2(nc(=o)nc(=o)c1=2)) * inchi-key: ** pfwlfwpasulgan-uhfffaoys...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THFOR2 THFOR2] ==
+
== Metabolite 7-METHYLXANTHINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 5,6,7,8-tetrahydrofolate:nadp+ oxidoreductase
+
** 7-methylxanthine
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[CPD-12826]][c] '''+''' 2.0 [[NADPH]][c] '''+''' 2.0 [[PROTON]][c] '''=>''' 2.0 [[NADP]][c] '''+''' 1.0 [[THF]][c]
+
** cn1(c=nc2(nc(=o)nc(=o)c1=2))
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ19601]]
+
** pfwlfwpasulgan-uhfffaoysa-n
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 166.139
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[RXN-11521]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=7-methylxanthine}}
−
{{#set: common-name=5,6,7,8-tetrahydrofolate:nadp+ oxidoreductase}}
+
{{#set: inchi-key=inchikey=pfwlfwpasulgan-uhfffaoysa-n}}
−
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=166.139}}
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:35, 18 December 2020

Metabolite 7-METHYLXANTHINE

  • common-name:
    • 7-methylxanthine
  • smiles:
    • cn1(c=nc2(nc(=o)nc(=o)c1=2))
  • inchi-key:
    • pfwlfwpasulgan-uhfffaoysa-n
  • molecular-weight:
    • 166.139

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8608&oldid=47503"