Difference between revisions of "CPD-8608"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7-METHYLXANTHINE == * common-name: ** 7-methylxanthine * smiles: ** cn1(c=nc2(nc(=o)nc(=o)c1=2)) * inchi-key: ** pfwlfwpasulgan-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite CPD-12762 == * common-name: ** (2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial * smiles: ** cc(=cc=o)c=cc=c(c=o)c * inchi-key: ** ppjgvkzrxc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12762 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cc=o)c=cc=c(c=o)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ppjgvkzrxchmcc-lnfqzqfxsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 164.204 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11783]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ppjgvkzrxchmcc-lnfqzqfxsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=164.204}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-12762
- common-name:
- (2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial
- smiles:
- cc(=cc=o)c=cc=c(c=o)c
- inchi-key:
- ppjgvkzrxchmcc-lnfqzqfxsa-n
- molecular-weight:
- 164.204
