Difference between revisions of "CPD-8610"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13404 == * common-name: ** l-alanyl-l-aspartate * smiles: ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o * inchi-key: ** xaewtdmgfghwfk-imjs...") |
(Created page with "Category:metabolite == Metabolite CPD-8610 == * common-name: ** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8610 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol |
* smiles: | * smiles: | ||
| − | ** cc([ | + | ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fyhrvinoxyetmn-qgbojxoesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 414.713 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-14]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fyhrvinoxyetmn-qgbojxoesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=414.713}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-8610
- common-name:
- 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
- smiles:
- cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c
- inchi-key:
- fyhrvinoxyetmn-qgbojxoesa-n
- molecular-weight:
- 414.713
