Difference between revisions of "CPD-8610"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18760 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-667 == * common-name: ** o-acetyl-l-homoserine * smiles: ** cc(occc(c([o-])=o)[n+])=o * inchi-key: ** fcxzbwsiaggpcb-yfkpbyrvsa-n * m...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-667 == |
| − | + | * common-name: | |
| − | * | + | ** o-acetyl-l-homoserine |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** cc(occc(c([o-])=o)[n+])=o |
| − | * | + | * inchi-key: |
| − | * | + | ** fcxzbwsiaggpcb-yfkpbyrvsa-n |
| − | * [[RXN | + | * molecular-weight: |
| − | * | + | ** 161.157 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | == | + | * [[ACETYLHOMOSER-CYS-RXN]] |
| − | + | * [[ACHMSSELCYSL]] | |
| − | + | * [[ACHMSSELCYSLh]] | |
| − | {{#set: | + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[ACETYLHOMOSER-CYS-RXN]] |
| + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=o-acetyl-l-homoserine}} | ||
| + | {{#set: inchi-key=inchikey=fcxzbwsiaggpcb-yfkpbyrvsa-n}} | ||
| + | {{#set: molecular-weight=161.157}} | ||
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-667
- common-name:
- o-acetyl-l-homoserine
- smiles:
- cc(occc(c([o-])=o)[n+])=o
- inchi-key:
- fcxzbwsiaggpcb-yfkpbyrvsa-n
- molecular-weight:
- 161.157
